| CAS-NR. |
298-07-7 |
| andere Namen |
P204 Diisooctyl Phosphate |
| MF |
[C8H17]2PO2H |
| Ort der Herkunft |
China (Mainland) |
| Reinheit |
95% |
| Marke |
Fopol |
| Modell-Nummer |
Fopol |
| Klassifikation |
spezifische Reagenzien |
Product Name Diisooctyl Phosphate(P204) MolecularFormula Molecular Weight [C8H17]2PO2H322.4Properties Colorless or yellowish transparent viscous oily liquid;Soluable to alcohol and some other organic solvents Burning Point 233οC Content % ≥95% Diacid % ≤2.0 Density(20°C)g/ml 0.9736-0.9756 Refractive index (ND25) 1.4434-1.4444 Acid value (mgKOH/g) 159-189 Chroma(Pt-Co) ≤100 Viscosity μ25CPS 42±3 Flash point(°C) ≥160 Phase Separation Speed (S) ≤100